2-Nitronaphthalene
 2-Nitronaphthalene | |
|---|---|
type of chemical entity (en)  | |
| Bayanai | |
| Ƙaramin ɓangare na |
mononitronaphthalenes (en) |
| Associated hazard (en) |
2-nitronaphthalene exposure (en) |
| Yana haddasa |
2-nitronaphthalene exposure (en) |
| Sinadaran dabara | C₁₀H₇NO₂ |
| Canonical SMILES (en) | C1=CC=C2C=C(C=CC2=C1)[N+](=O)[O-] |
| NIOSH Pocket Guide ID (en) | 0458 |
| Has characteristic (en) |
flammable solid (en) |
| Subject has role (en) |
occupational carcinogen (en) |
2-Nitronaphthalene wani fili ne na kwayoyin halitta tare da dabarar C10H7NO2. Yana daya daga cikin isomers biyu na nitronaphthalene, ɗayan kuma shine 1-nitronaphthalene. 2-Nitronaphthalene ana samar da shi a cikin ƙananan yawan amfanin ƙasa akan nitration na naphthalene, amma ana iya samun shi da kyau ta hanyar diazotization na 2-aminonaphthalene[1]
Manazarta
[gyara sashe | gyara masomin]- ↑ Booth, Gerald (2000). "Nitro Compounds, Aromatic". Ullmann's Encyclopedia of Industrial Chemistry. Weinheim: Wiley-VCH. doi:10.1002/14356007.a17_411. ISBN 3527306730.