2-Nitronaphthalene
Appearance
![]() | |
---|---|
type of chemical entity (en) ![]() | |
Bayanai | |
Ƙaramin ɓangare na |
mononitronaphthalenes (en) ![]() |
Associated hazard (en) ![]() |
2-nitronaphthalene exposure (en) ![]() |
Yana haddasa |
2-nitronaphthalene exposure (en) ![]() |
Sinadaran dabara | C₁₀H₇NO₂ |
Canonical SMILES (en) ![]() | C1=CC=C2C=C(C=CC2=C1)[N+](=O)[O-] |
NIOSH Pocket Guide ID (en) ![]() | 0458 |
Has characteristic (en) ![]() |
flammable solid (en) ![]() |
Subject has role (en) ![]() |
occupational carcinogen (en) ![]() |
2-Nitronaphthalene wani fili ne na kwayoyin halitta tare da dabarar C10H7NO2. Yana daya daga cikin isomers biyu na nitronaphthalene, ɗayan kuma shine 1-nitronaphthalene. 2-Nitronaphthalene ana samar da shi a cikin ƙananan yawan amfanin ƙasa akan nitration na naphthalene, amma ana iya samun shi da kyau ta hanyar diazotization na 2-aminonaphthalene[1]
Manazarta
[gyara sashe | gyara masomin]- ↑ Booth, Gerald (2000). "Nitro Compounds, Aromatic". Ullmann's Encyclopedia of Industrial Chemistry. Weinheim: Wiley-VCH. doi:10.1002/14356007.a17_411. ISBN 3527306730.